C15H20F2N2O2 — CID 81265246
2-cyclopropyl-3-(2,6-difluorophenoxy)-2-(propylamino)propanamide (PubChem CID 81265246) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-cyclopropyl-3-(2,6-difluorophenoxy)-2-(propylamino)propanamide.
| Compound Name | 2-cyclopropyl-3-(2,6-difluorophenoxy)-2-(propylamino)propanamide |
|---|---|
| PubChem CID | 81265246 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-cyclopropyl-3-(2,6-difluorophenoxy)-2-(propylamino)propanamide |
| SMILES | CCCNC(COc1c(F)cccc1F)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-2-8-19-15(14(18)20,10-6-7-10)9-21-13-11(16)4-3-5-12(13)17/h3-5,10,19H,2,6-9H2,1H3,(H2,18,20) |
| InChIKey | XFEWWOXIDVTPOY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |