C14H10ClFN2O3 — CID 81266256
5-[[(3-chloro-2-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid (PubChem CID 81266256) has the molecular formula C14H10ClFN2O3 and a molecular weight of 308.70 g/mol. Its IUPAC name is 5-[[(3-chloro-2-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[(3-chloro-2-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 81266256 |
| Molecular Formula | C14H10ClFN2O3 |
| Molecular Weight | 308.70 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 5-[[(3-chloro-2-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2cccc(Cl)c2F)cn1 |
| InChI | InChI=1S/C14H10ClFN2O3/c15-10-3-1-2-9(12(10)16)13(19)18-7-8-4-5-11(14(20)21)17-6-8/h1-6H,7H2,(H,18,19)(H,20,21) |
| InChIKey | TYSPVVJLKVFTIK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |