C18H17BrN2 — CID 81267157
1-(6-bromonaphthalen-2-yl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 81267157) has the molecular formula C18H17BrN2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 1-(6-bromonaphthalen-2-yl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-(6-bromonaphthalen-2-yl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 81267157 |
| Molecular Formula | C18H17BrN2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(6-bromonaphthalen-2-yl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | NC1CCCc2c1ccn2-c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C18H17BrN2/c19-14-6-4-13-11-15(7-5-12(13)10-14)21-9-8-16-17(20)2-1-3-18(16)21/h4-11,17H,1-3,20H2 |
| InChIKey | CGIAZWVOTAWXRA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |