C14H18F3N3S — CID 81269941
2-methyl-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide (PubChem CID 81269941) has the molecular formula C14H18F3N3S and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-methyl-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide.
| Compound Name | 2-methyl-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 81269941 |
| Molecular Formula | C14H18F3N3S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-methyl-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide |
| SMILES | Cc1cc(N2CCN(CC(F)(F)F)CC2)ccc1C(N)=S |
| InChI | InChI=1S/C14H18F3N3S/c1-10-8-11(2-3-12(10)13(18)21)20-6-4-19(5-7-20)9-14(15,16)17/h2-3,8H,4-7,9H2,1H3,(H2,18,21) |
| InChIKey | DULLXJRMGALPNQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|