About 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline
2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline (PubChem CID 81270264) has the molecular formula C14H10BrClF3N
and a molecular weight of 364.59 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline.
Molecular Properties
| Compound Name | 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline |
| PubChem CID | 81270264 |
| Molecular Formula | C14H10BrClF3N |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline |
| SMILES | FC(F)(F)C(Nc1ccc(Cl)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C14H10BrClF3N/c15-11-8-10(16)6-7-12(11)20-13(14(17,18)19)9-4-2-1-3-5-9/h1-8,13,20H |
| InChIKey | DHGSUZUVWCDEGL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline?
The IUPAC name of 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline (CID 81270264) is 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline.
What is the SMILES notation for 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline?
The canonical SMILES for 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline is FC(F)(F)C(Nc1ccc(Cl)cc1Br)c1ccccc1.
What is the InChIKey of 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline?
The InChIKey is DHGSUZUVWCDEGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrClF3N/c15-11-8-10(16)6-7-12(11)20-13(14(17,18)19)9-4-2-1-3-5-9/h1-8,13,20H.
What are the key properties of 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline?
2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline has a molecular weight of 364.59 g/mol, XLogP of 5.82, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-chloro-N-(2,2,2-trifluoro-1-phenylethyl)aniline is sourced from PubChem (CID 81270264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).