C14H13BrClNO — CID 81274785
1-(2-bromo-5-chlorophenyl)-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 81274785) has the molecular formula C14H13BrClNO and a molecular weight of 326.62 g/mol. Its IUPAC name is 1-(2-bromo-5-chlorophenyl)-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(2-bromo-5-chlorophenyl)-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 81274785 |
| Molecular Formula | C14H13BrClNO |
| Molecular Weight | 326.62 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 1-(2-bromo-5-chlorophenyl)-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | OC1CCCc2c1ccn2-c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C14H13BrClNO/c15-11-5-4-9(16)8-13(11)17-7-6-10-12(17)2-1-3-14(10)18/h4-8,14,18H,1-3H2 |
| InChIKey | JIWQELATPJXDDV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |