C15H24N2S — CID 81277688
2-methyl-4-(5-methylhexan-2-ylamino)benzenecarbothioamide (PubChem CID 81277688) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 2-methyl-4-(5-methylhexan-2-ylamino)benzenecarbothioamide.
| Compound Name | 2-methyl-4-(5-methylhexan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 81277688 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-methyl-4-(5-methylhexan-2-ylamino)benzenecarbothioamide |
| SMILES | Cc1cc(NC(C)CCC(C)C)ccc1C(N)=S |
| InChI | InChI=1S/C15H24N2S/c1-10(2)5-6-12(4)17-13-7-8-14(15(16)18)11(3)9-13/h7-10,12,17H,5-6H2,1-4H3,(H2,16,18) |
| InChIKey | ZCCBCHNMFBVWJF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|