C17H26N2S — CID 81278074
4-[(4,4-dimethylcyclohexyl)-methylamino]-2-methylbenzenecarbothioamide (PubChem CID 81278074) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 4-[(4,4-dimethylcyclohexyl)-methylamino]-2-methylbenzenecarbothioamide.
| Compound Name | 4-[(4,4-dimethylcyclohexyl)-methylamino]-2-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 81278074 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 4-[(4,4-dimethylcyclohexyl)-methylamino]-2-methylbenzenecarbothioamide |
| SMILES | Cc1cc(N(C)C2CCC(C)(C)CC2)ccc1C(N)=S |
| InChI | InChI=1S/C17H26N2S/c1-12-11-14(5-6-15(12)16(18)20)19(4)13-7-9-17(2,3)10-8-13/h5-6,11,13H,7-10H2,1-4H3,(H2,18,20) |
| InChIKey | AMIZAPIFEWRGGD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|