C14H23NO — CID 81279223
[2-methyl-4-(4-methylpentoxy)phenyl]methanamine (PubChem CID 81279223) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is [2-methyl-4-(4-methylpentoxy)phenyl]methanamine.
| Compound Name | [2-methyl-4-(4-methylpentoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 81279223 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | [2-methyl-4-(4-methylpentoxy)phenyl]methanamine |
| SMILES | Cc1cc(OCCCC(C)C)ccc1CN |
| InChI | InChI=1S/C14H23NO/c1-11(2)5-4-8-16-14-7-6-13(10-15)12(3)9-14/h6-7,9,11H,4-5,8,10,15H2,1-3H3 |
| InChIKey | IIPOYFPNPJHSHC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|