C18H25N3O2S — CID 812804
2-methylpropyl (6R)-6-(3-aminophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 812804) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-methylpropyl (6R)-6-(3-aminophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methylpropyl (6R)-6-(3-aminophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 812804 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-methylpropyl (6R)-6-(3-aminophenyl)-3-ethyl-4-methyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCN1C(=S)N[C@H](c2cccc(N)c2)C(C(=O)OCC(C)C)=C1C |
| InChI | InChI=1S/C18H25N3O2S/c1-5-21-12(4)15(17(22)23-10-11(2)3)16(20-18(21)24)13-7-6-8-14(19)9-13/h6-9,11,16H,5,10,19H2,1-4H3,(H,20,24)/t16-/m1/s1 |
| InChIKey | KYEVNQSCNLVBAV-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|