C14H9Br2Cl2N3 — CID 81281193
6-bromo-3-(2-bromo-5-chlorophenyl)-2-(2-chloroethyl)imidazo[4,5-b]pyridine (PubChem CID 81281193) has the molecular formula C14H9Br2Cl2N3 and a molecular weight of 449.96 g/mol. Its IUPAC name is 6-bromo-3-(2-bromo-5-chlorophenyl)-2-(2-chloroethyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-3-(2-bromo-5-chlorophenyl)-2-(2-chloroethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 81281193 |
| Molecular Formula | C14H9Br2Cl2N3 |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 446.85 |
| IUPAC Name | 6-bromo-3-(2-bromo-5-chlorophenyl)-2-(2-chloroethyl)imidazo[4,5-b]pyridine |
| SMILES | ClCCc1nc2cc(Br)cnc2n1-c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C14H9Br2Cl2N3/c15-8-5-11-14(19-7-8)21(13(20-11)3-4-17)12-6-9(18)1-2-10(12)16/h1-2,5-7H,3-4H2 |
| InChIKey | KTPMDJQWFXNWRO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|