C14H18O4 — CID 81282466
2-methyl-4-(oxan-4-ylmethoxy)benzoic acid (PubChem CID 81282466) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-methyl-4-(oxan-4-ylmethoxy)benzoic acid.
| Compound Name | 2-methyl-4-(oxan-4-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 81282466 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-methyl-4-(oxan-4-ylmethoxy)benzoic acid |
| SMILES | Cc1cc(OCC2CCOCC2)ccc1C(=O)O |
| InChI | InChI=1S/C14H18O4/c1-10-8-12(2-3-13(10)14(15)16)18-9-11-4-6-17-7-5-11/h2-3,8,11H,4-7,9H2,1H3,(H,15,16) |
| InChIKey | RSWFYOCPZWXGTM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |