C15H21N3 — CID 81282499
4-(3-ethyl-4-methylpiperazin-1-yl)-2-methylbenzonitrile (PubChem CID 81282499) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-(3-ethyl-4-methylpiperazin-1-yl)-2-methylbenzonitrile.
| Compound Name | 4-(3-ethyl-4-methylpiperazin-1-yl)-2-methylbenzonitrile |
|---|---|
| PubChem CID | 81282499 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-(3-ethyl-4-methylpiperazin-1-yl)-2-methylbenzonitrile |
| SMILES | CCC1CN(c2ccc(C#N)c(C)c2)CCN1C |
| InChI | InChI=1S/C15H21N3/c1-4-14-11-18(8-7-17(14)3)15-6-5-13(10-16)12(2)9-15/h5-6,9,14H,4,7-8,11H2,1-3H3 |
| InChIKey | JAGIFOZAYBUGTQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |