C13H17N3O — CID 81282642
2-(4-cyano-N,3-dimethylanilino)-N,N-dimethylacetamide (PubChem CID 81282642) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(4-cyano-N,3-dimethylanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(4-cyano-N,3-dimethylanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 81282642 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(4-cyano-N,3-dimethylanilino)-N,N-dimethylacetamide |
| SMILES | Cc1cc(N(C)CC(=O)N(C)C)ccc1C#N |
| InChI | InChI=1S/C13H17N3O/c1-10-7-12(6-5-11(10)8-14)16(4)9-13(17)15(2)3/h5-7H,9H2,1-4H3 |
| InChIKey | QSQOGCSRAVKHLK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |