C12H13FN2O5 — CID 81282859
(2S)-4-amino-2-[(4-fluoro-3-methoxybenzoyl)amino]-4-oxobutanoic acid (PubChem CID 81282859) has the molecular formula C12H13FN2O5 and a molecular weight of 284.24 g/mol. Its IUPAC name is (2S)-4-amino-2-[(4-fluoro-3-methoxybenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(4-fluoro-3-methoxybenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 81282859 |
| Molecular Formula | C12H13FN2O5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (2S)-4-amino-2-[(4-fluoro-3-methoxybenzoyl)amino]-4-oxobutanoic acid |
| SMILES | COc1cc(C(=O)N[C@@H](CC(N)=O)C(=O)O)ccc1F |
| InChI | InChI=1S/C12H13FN2O5/c1-20-9-4-6(2-3-7(9)13)11(17)15-8(12(18)19)5-10(14)16/h2-4,8H,5H2,1H3,(H2,14,16)(H,15,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | LKVHXASXGBEBIV-QMMMGPOBSA-N |
| XLogP | -0.11 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |