About 4-(dibutylamino)-3,5-difluorobenzonitrile
4-(dibutylamino)-3,5-difluorobenzonitrile (PubChem CID 81282963) has the molecular formula C15H20F2N2
and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-(dibutylamino)-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(dibutylamino)-3,5-difluorobenzonitrile |
| PubChem CID | 81282963 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-(dibutylamino)-3,5-difluorobenzonitrile |
| SMILES | CCCCN(CCCC)c1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C15H20F2N2/c1-3-5-7-19(8-6-4-2)15-13(16)9-12(11-18)10-14(15)17/h9-10H,3-8H2,1-2H3 |
| InChIKey | YNGAZHLCUJRVJR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(dibutylamino)-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dibutylamino)-3,5-difluorobenzonitrile?
The IUPAC name of 4-(dibutylamino)-3,5-difluorobenzonitrile (CID 81282963) is 4-(dibutylamino)-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-(dibutylamino)-3,5-difluorobenzonitrile?
The canonical SMILES for 4-(dibutylamino)-3,5-difluorobenzonitrile is CCCCN(CCCC)c1c(F)cc(C#N)cc1F.
What is the InChIKey of 4-(dibutylamino)-3,5-difluorobenzonitrile?
The InChIKey is YNGAZHLCUJRVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2/c1-3-5-7-19(8-6-4-2)15-13(16)9-12(11-18)10-14(15)17/h9-10H,3-8H2,1-2H3.
What are the key properties of 4-(dibutylamino)-3,5-difluorobenzonitrile?
4-(dibutylamino)-3,5-difluorobenzonitrile has a molecular weight of 266.33 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibutylamino)-3,5-difluorobenzonitrile is sourced from PubChem (CID 81282963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).