C16H18F2N2 — CID 81282970
4-(2-cyclopentylpyrrolidin-1-yl)-3,5-difluorobenzonitrile (PubChem CID 81282970) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-(2-cyclopentylpyrrolidin-1-yl)-3,5-difluorobenzonitrile.
| Compound Name | 4-(2-cyclopentylpyrrolidin-1-yl)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81282970 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-(2-cyclopentylpyrrolidin-1-yl)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(N2CCCC2C2CCCC2)c(F)c1 |
| InChI | InChI=1S/C16H18F2N2/c17-13-8-11(10-19)9-14(18)16(13)20-7-3-6-15(20)12-4-1-2-5-12/h8-9,12,15H,1-7H2 |
| InChIKey | KNYNZWLVTIIQLV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |