C16H14BrFO2 — CID 81284360
5-[bromo-(4-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 81284360) has the molecular formula C16H14BrFO2 and a molecular weight of 337.19 g/mol. Its IUPAC name is 5-[bromo-(4-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[bromo-(4-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 81284360 |
| Molecular Formula | C16H14BrFO2 |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5-[bromo-(4-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | COc1cc(C(Br)c2ccc3c(c2)CCO3)ccc1F |
| InChI | InChI=1S/C16H14BrFO2/c1-19-15-9-12(2-4-13(15)18)16(17)11-3-5-14-10(8-11)6-7-20-14/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | LSRXCPDSHFAPCE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|