About 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide
4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide (PubChem CID 81285451) has the molecular formula C15H14F2N2S
and a molecular weight of 292.35 g/mol. Its IUPAC name is 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide.
Molecular Properties
| Compound Name | 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide |
| PubChem CID | 81285451 |
| Molecular Formula | C15H14F2N2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide |
| SMILES | Cc1ccc(N(C)c2c(F)cc(C(N)=S)cc2F)cc1 |
| InChI | InChI=1S/C15H14F2N2S/c1-9-3-5-11(6-4-9)19(2)14-12(16)7-10(15(18)20)8-13(14)17/h3-8H,1-2H3,(H2,18,20) |
| InChIKey | MBXBXMMRAXSJHG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide?
The IUPAC name of 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide (CID 81285451) is 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide.
What is the SMILES notation for 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide?
The canonical SMILES for 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide is Cc1ccc(N(C)c2c(F)cc(C(N)=S)cc2F)cc1.
What is the InChIKey of 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide?
The InChIKey is MBXBXMMRAXSJHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2S/c1-9-3-5-11(6-4-9)19(2)14-12(16)7-10(15(18)20)8-13(14)17/h3-8H,1-2H3,(H2,18,20).
What are the key properties of 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide?
4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide has a molecular weight of 292.35 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N,4-dimethylanilino)-3,5-difluorobenzenecarbothioamide is sourced from PubChem (CID 81285451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).