About 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide
4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide (PubChem CID 81286009) has the molecular formula C13H11F2N3S2
and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide.
Molecular Properties
| Compound Name | 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide |
| PubChem CID | 81286009 |
| Molecular Formula | C13H11F2N3S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(Nc2nc(C3CC3)cs2)c(F)c1 |
| InChI | InChI=1S/C13H11F2N3S2/c14-8-3-7(12(16)19)4-9(15)11(8)18-13-17-10(5-20-13)6-1-2-6/h3-6H,1-2H2,(H2,16,19)(H,17,18) |
| InChIKey | MSQLWEJLAZGYLU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide?
The IUPAC name of 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide (CID 81286009) is 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide.
What is the SMILES notation for 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide?
The canonical SMILES for 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide is NC(=S)c1cc(F)c(Nc2nc(C3CC3)cs2)c(F)c1.
What is the InChIKey of 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide?
The InChIKey is MSQLWEJLAZGYLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2N3S2/c14-8-3-7(12(16)19)4-9(15)11(8)18-13-17-10(5-20-13)6-1-2-6/h3-6H,1-2H2,(H2,16,19)(H,17,18).
What are the key properties of 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide?
4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide has a molecular weight of 311.38 g/mol, XLogP of 3.68, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,5-difluorobenzenecarbothioamide is sourced from PubChem (CID 81286009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).