About 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile
4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile (PubChem CID 81286522) has the molecular formula C12H12F2N2O
and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile |
| PubChem CID | 81286522 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(OC2CC(CN)C2)c(F)c1 |
| InChI | InChI=1S/C12H12F2N2O/c13-10-3-8(6-16)4-11(14)12(10)17-9-1-7(2-9)5-15/h3-4,7,9H,1-2,5,15H2 |
| InChIKey | BYMDIFZUOFHIIG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile?
The IUPAC name of 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile (CID 81286522) is 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile?
The canonical SMILES for 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile is N#Cc1cc(F)c(OC2CC(CN)C2)c(F)c1.
What is the InChIKey of 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile?
The InChIKey is BYMDIFZUOFHIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N2O/c13-10-3-8(6-16)4-11(14)12(10)17-9-1-7(2-9)5-15/h3-4,7,9H,1-2,5,15H2.
What are the key properties of 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile?
4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile has a molecular weight of 238.24 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(aminomethyl)cyclobutyl]oxy-3,5-difluorobenzonitrile is sourced from PubChem (CID 81286522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).