About 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline
4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline (PubChem CID 81287065) has the molecular formula C18H23BrN2
and a molecular weight of 347.30 g/mol. Its IUPAC name is 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline.
Molecular Properties
| Compound Name | 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline |
| PubChem CID | 81287065 |
| Molecular Formula | C18H23BrN2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline |
| SMILES | CCc1cc(Br)ccc1NC(C)c1c(C)cc(C)nc1C |
| InChI | InChI=1S/C18H23BrN2/c1-6-15-10-16(19)7-8-17(15)21-14(5)18-11(2)9-12(3)20-13(18)4/h7-10,14,21H,6H2,1-5H3 |
| InChIKey | PQQLNNOLJLQKKK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline?
The IUPAC name of 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline (CID 81287065) is 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline.
What is the SMILES notation for 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline?
The canonical SMILES for 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline is CCc1cc(Br)ccc1NC(C)c1c(C)cc(C)nc1C.
What is the InChIKey of 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline?
The InChIKey is PQQLNNOLJLQKKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23BrN2/c1-6-15-10-16(19)7-8-17(15)21-14(5)18-11(2)9-12(3)20-13(18)4/h7-10,14,21H,6H2,1-5H3.
What are the key properties of 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline?
4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline has a molecular weight of 347.30 g/mol, XLogP of 5.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-ethyl-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]aniline is sourced from PubChem (CID 81287065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).