C15H21N3O — CID 81287127
1-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-3-propylurea (PubChem CID 81287127) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-3-propylurea.
| Compound Name | 1-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-3-propylurea |
|---|---|
| PubChem CID | 81287127 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-[4-(3-aminoprop-1-ynyl)-2-ethylphenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc(C#CCN)cc1CC |
| InChI | InChI=1S/C15H21N3O/c1-3-10-17-15(19)18-14-8-7-12(6-5-9-16)11-13(14)4-2/h7-8,11H,3-4,9-10,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | AOOHTJYFRGCVBE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|