C15H12BrFIN3 — CID 81287131
1-(4-bromo-2-ethylphenyl)-6-fluoro-5-iodobenzimidazol-2-amine (PubChem CID 81287131) has the molecular formula C15H12BrFIN3 and a molecular weight of 460.09 g/mol. Its IUPAC name is 1-(4-bromo-2-ethylphenyl)-6-fluoro-5-iodobenzimidazol-2-amine.
| Compound Name | 1-(4-bromo-2-ethylphenyl)-6-fluoro-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 81287131 |
| Molecular Formula | C15H12BrFIN3 |
| Molecular Weight | 460.09 g/mol |
| Exact Mass | 458.92 |
| IUPAC Name | 1-(4-bromo-2-ethylphenyl)-6-fluoro-5-iodobenzimidazol-2-amine |
| SMILES | CCc1cc(Br)ccc1-n1c(N)nc2cc(I)c(F)cc21 |
| InChI | InChI=1S/C15H12BrFIN3/c1-2-8-5-9(16)3-4-13(8)21-14-6-10(17)11(18)7-12(14)20-15(21)19/h3-7H,2H2,1H3,(H2,19,20) |
| InChIKey | YMFJJWTWVDYDAR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.09 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|