C16H20BrNO — CID 81287175
1-[5-(4-bromo-2-ethylphenyl)furan-2-yl]-N-methylpropan-2-amine (PubChem CID 81287175) has the molecular formula C16H20BrNO and a molecular weight of 322.25 g/mol. Its IUPAC name is 1-[5-(4-bromo-2-ethylphenyl)furan-2-yl]-N-methylpropan-2-amine.
| Compound Name | 1-[5-(4-bromo-2-ethylphenyl)furan-2-yl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 81287175 |
| Molecular Formula | C16H20BrNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[5-(4-bromo-2-ethylphenyl)furan-2-yl]-N-methylpropan-2-amine |
| SMILES | CCc1cc(Br)ccc1-c1ccc(CC(C)NC)o1 |
| InChI | InChI=1S/C16H20BrNO/c1-4-12-10-13(17)5-7-15(12)16-8-6-14(19-16)9-11(2)18-3/h5-8,10-11,18H,4,9H2,1-3H3 |
| InChIKey | ZEVAJHNMGRDUFO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |