C15H21BrN2S — CID 81288365
N-(4-bromo-2-ethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine (PubChem CID 81288365) has the molecular formula C15H21BrN2S and a molecular weight of 341.32 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(4-bromo-2-ethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 81288365 |
| Molecular Formula | C15H21BrN2S |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine |
| SMILES | CCc1cc(Br)ccc1NC1=NC(CC)(CC)CS1 |
| InChI | InChI=1S/C15H21BrN2S/c1-4-11-9-12(16)7-8-13(11)17-14-18-15(5-2,6-3)10-19-14/h7-9H,4-6,10H2,1-3H3,(H,17,18) |
| InChIKey | RDNYVLYZQXFZHT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |