C15H17BrN2 — CID 81289505
7-bromo-5-ethyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 81289505) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 7-bromo-5-ethyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-bromo-5-ethyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 81289505 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 7-bromo-5-ethyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCc1cc(Br)cc2c(N)c3c(nc12)CCCC3 |
| InChI | InChI=1S/C15H17BrN2/c1-2-9-7-10(16)8-12-14(17)11-5-3-4-6-13(11)18-15(9)12/h7-8H,2-6H2,1H3,(H2,17,18) |
| InChIKey | SRVBOVLRXQRGJB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |