C16H16BrF2NO — CID 81289888
4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethylaniline (PubChem CID 81289888) has the molecular formula C16H16BrF2NO and a molecular weight of 356.21 g/mol. Its IUPAC name is 4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethylaniline.
| Compound Name | 4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethylaniline |
|---|---|
| PubChem CID | 81289888 |
| Molecular Formula | C16H16BrF2NO |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethylaniline |
| SMILES | CCc1cc(Br)ccc1NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H16BrF2NO/c1-2-11-9-13(17)7-8-14(11)20-10-12-5-3-4-6-15(12)21-16(18)19/h3-9,16,20H,2,10H2,1H3 |
| InChIKey | WNSSIQVMBPGMML-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |