C14H14Br2ClNS — CID 81291295
N-[(4-bromo-3-chlorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 81291295) has the molecular formula C14H14Br2ClNS and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[(4-bromo-3-chlorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-3-chlorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81291295 |
| Molecular Formula | C14H14Br2ClNS |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | N-[(4-bromo-3-chlorophenyl)-(5-bromo-4-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)c(Cl)c1)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C14H14Br2ClNS/c1-3-18-13(12-6-8(2)14(16)19-12)9-4-5-10(15)11(17)7-9/h4-7,13,18H,3H2,1-2H3 |
| InChIKey | FUQWQUQTDHMHMU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |