C11H16BrNO2 — CID 81292963
(2S)-3-(4-bromo-2-ethylanilino)propane-1,2-diol (PubChem CID 81292963) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is (2S)-3-(4-bromo-2-ethylanilino)propane-1,2-diol.
| Compound Name | (2S)-3-(4-bromo-2-ethylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 81292963 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (2S)-3-(4-bromo-2-ethylanilino)propane-1,2-diol |
| SMILES | CCc1cc(Br)ccc1NC[C@H](O)CO |
| InChI | InChI=1S/C11H16BrNO2/c1-2-8-5-9(12)3-4-11(8)13-6-10(15)7-14/h3-5,10,13-15H,2,6-7H2,1H3/t10-/m0/s1 |
| InChIKey | HGQWVKREJGWMFT-JTQLQIEISA-N |
| XLogP | 1.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |