C10H8F2N4OS — CID 81293390
3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenecarboximidamide (PubChem CID 81293390) has the molecular formula C10H8F2N4OS and a molecular weight of 270.26 g/mol. Its IUPAC name is 3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 81293390 |
| Molecular Formula | C10H8F2N4OS |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3,5-difluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(Sc2nnc(C)o2)c(F)c1 |
| InChI | InChI=1S/C10H8F2N4OS/c1-4-15-16-10(17-4)18-8-6(11)2-5(9(13)14)3-7(8)12/h2-3H,1H3,(H3,13,14) |
| InChIKey | OMFRYQSNYFKIPT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|