C15H18ClN3O2 — CID 81294763
4-(3-aminoprop-1-ynyl)-3-chloro-N-ethyl-N-[2-(methylamino)-2-oxoethyl]benzamide (PubChem CID 81294763) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-3-chloro-N-ethyl-N-[2-(methylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-3-chloro-N-ethyl-N-[2-(methylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 81294763 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-3-chloro-N-ethyl-N-[2-(methylamino)-2-oxoethyl]benzamide |
| SMILES | CCN(CC(=O)NC)C(=O)c1ccc(C#CCN)c(Cl)c1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-3-19(10-14(20)18-2)15(21)12-7-6-11(5-4-8-17)13(16)9-12/h6-7,9H,3,8,10,17H2,1-2H3,(H,18,20) |
| InChIKey | HZUCTGVQUOWLLI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|