About 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid
2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid (PubChem CID 81297608) has the molecular formula C7H9FN2O2
and a molecular weight of 172.16 g/mol. Its IUPAC name is 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid.
Molecular Properties
| Compound Name | 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid |
| PubChem CID | 81297608 |
| Molecular Formula | C7H9FN2O2 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid |
| SMILES | Cc1ncn(C(F)C(=O)O)c1C |
| InChI | InChI=1S/C7H9FN2O2/c1-4-5(2)10(3-9-4)6(8)7(11)12/h3,6H,1-2H3,(H,11,12) |
| InChIKey | SYKNSQBDAJEWPU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid?
The IUPAC name of 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid (CID 81297608) is 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid.
What is the SMILES notation for 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid?
The canonical SMILES for 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid is Cc1ncn(C(F)C(=O)O)c1C.
What is the InChIKey of 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid?
The InChIKey is SYKNSQBDAJEWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O2/c1-4-5(2)10(3-9-4)6(8)7(11)12/h3,6H,1-2H3,(H,11,12).
What are the key properties of 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid?
2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid has a molecular weight of 172.16 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetic acid is sourced from PubChem (CID 81297608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).