2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid

C8H9FN2O3 — CID 81297619

IUPAC2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid
SMILESCc1cc(=O)n(C(F)C(=O)O)c(C)n1
InChIInChI=1S/C8H9FN2O3/c1-4-3-6(12)11(5(2)10-4)7(9)8(13)14/h3,7H,1-2H3,(H,13,14)
InChIKeyOWABDOJBBLCFCS-UHFFFAOYSA-N
MW200.17 g/mol
LogP0.41
Rot. Bonds2

About 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid

2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid (PubChem CID 81297619) has the molecular formula C8H9FN2O3 and a molecular weight of 200.17 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid.

Molecular Properties

Compound Name2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid
PubChem CID81297619
Molecular FormulaC8H9FN2O3
Molecular Weight200.17 g/mol
Exact Mass200.06
IUPAC Name2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid
SMILESCc1cc(=O)n(C(F)C(=O)O)c(C)n1
InChIInChI=1S/C8H9FN2O3/c1-4-3-6(12)11(5(2)10-4)7(9)8(13)14/h3,7H,1-2H3,(H,13,14)
InChIKeyOWABDOJBBLCFCS-UHFFFAOYSA-N
XLogP0.41
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.17
LogP ≤ 50.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid?
The IUPAC name of 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid (CID 81297619) is 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid.
What is the SMILES notation for 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid?
The canonical SMILES for 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid is Cc1cc(=O)n(C(F)C(=O)O)c(C)n1.
What is the InChIKey of 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid?
The InChIKey is OWABDOJBBLCFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O3/c1-4-3-6(12)11(5(2)10-4)7(9)8(13)14/h3,7H,1-2H3,(H,13,14).
What are the key properties of 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid?
2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid has a molecular weight of 200.17 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethyl-6-oxopyrimidin-1-yl)-2-fluoroacetic acid is sourced from PubChem (CID 81297619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).