About 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid
2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid (PubChem CID 81297738) has the molecular formula C6H6FNO3S
and a molecular weight of 191.18 g/mol. Its IUPAC name is 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid |
| PubChem CID | 81297738 |
| Molecular Formula | C6H6FNO3S |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid |
| SMILES | Cc1csc(=O)n1C(F)C(=O)O |
| InChI | InChI=1S/C6H6FNO3S/c1-3-2-12-6(11)8(3)4(7)5(9)10/h2,4H,1H3,(H,9,10) |
| InChIKey | PFPDUJYUPPFWIO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid?
The IUPAC name of 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid (CID 81297738) is 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid.
What is the SMILES notation for 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid?
The canonical SMILES for 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid is Cc1csc(=O)n1C(F)C(=O)O.
What is the InChIKey of 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid?
The InChIKey is PFPDUJYUPPFWIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO3S/c1-3-2-12-6(11)8(3)4(7)5(9)10/h2,4H,1H3,(H,9,10).
What are the key properties of 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid?
2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid has a molecular weight of 191.18 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetic acid is sourced from PubChem (CID 81297738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).