About ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate
ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate (PubChem CID 81297761) has the molecular formula C9H13FN2O2
and a molecular weight of 200.21 g/mol. Its IUPAC name is ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate |
| PubChem CID | 81297761 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)n1cnc(C)c1C |
| InChI | InChI=1S/C9H13FN2O2/c1-4-14-9(13)8(10)12-5-11-6(2)7(12)3/h5,8H,4H2,1-3H3 |
| InChIKey | YPMJGQWMKPAURA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate?
The IUPAC name of ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate (CID 81297761) is ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate.
What is the SMILES notation for ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate?
The canonical SMILES for ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate is CCOC(=O)C(F)n1cnc(C)c1C.
What is the InChIKey of ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate?
The InChIKey is YPMJGQWMKPAURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2O2/c1-4-14-9(13)8(10)12-5-11-6(2)7(12)3/h5,8H,4H2,1-3H3.
What are the key properties of ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate?
ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate has a molecular weight of 200.21 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,5-dimethylimidazol-1-yl)-2-fluoroacetate is sourced from PubChem (CID 81297761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).