C16H31N3 — CID 81298387
N-(1,2,5-trimethylpiperidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 81298387) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N-(1,2,5-trimethylpiperidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | N-(1,2,5-trimethylpiperidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 81298387 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N-(1,2,5-trimethylpiperidin-4-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | CC1CN(C)C(C)CC1NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C16H31N3/c1-12-11-18(3)13(2)9-16(12)17-14-6-8-19-7-4-5-15(19)10-14/h12-17H,4-11H2,1-3H3 |
| InChIKey | VCGVZKQWRRCPOB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |