About ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate
ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate (PubChem CID 81298557) has the molecular formula C11H14FN3O6
and a molecular weight of 303.25 g/mol. Its IUPAC name is ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate |
| PubChem CID | 81298557 |
| Molecular Formula | C11H14FN3O6 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate |
| SMILES | CCCn1cc([N+](=O)[O-])c(=O)n(C(F)C(=O)OCC)c1=O |
| InChI | InChI=1S/C11H14FN3O6/c1-3-5-13-6-7(15(19)20)9(16)14(11(13)18)8(12)10(17)21-4-2/h6,8H,3-5H2,1-2H3 |
| InChIKey | HSMUCNJJNKKPRI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 113.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate?
The IUPAC name of ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate (CID 81298557) is ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate.
What is the SMILES notation for ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate?
The canonical SMILES for ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate is CCCn1cc([N+](=O)[O-])c(=O)n(C(F)C(=O)OCC)c1=O.
What is the InChIKey of ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate?
The InChIKey is HSMUCNJJNKKPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN3O6/c1-3-5-13-6-7(15(19)20)9(16)14(11(13)18)8(12)10(17)21-4-2/h6,8H,3-5H2,1-2H3.
What are the key properties of ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate?
ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate has a molecular weight of 303.25 g/mol, XLogP of 0.36, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetate is sourced from PubChem (CID 81298557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).