About 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid
2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid (PubChem CID 81298641) has the molecular formula C9H10FN3O6
and a molecular weight of 275.19 g/mol. Its IUPAC name is 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid |
| PubChem CID | 81298641 |
| Molecular Formula | C9H10FN3O6 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid |
| SMILES | CCCn1cc([N+](=O)[O-])c(=O)n(C(F)C(=O)O)c1=O |
| InChI | InChI=1S/C9H10FN3O6/c1-2-3-11-4-5(13(18)19)7(14)12(9(11)17)6(10)8(15)16/h4,6H,2-3H2,1H3,(H,15,16) |
| InChIKey | MYMURPKQWVPECF-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid?
The IUPAC name of 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid (CID 81298641) is 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid.
What is the SMILES notation for 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid?
The canonical SMILES for 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid is CCCn1cc([N+](=O)[O-])c(=O)n(C(F)C(=O)O)c1=O.
What is the InChIKey of 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid?
The InChIKey is MYMURPKQWVPECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O6/c1-2-3-11-4-5(13(18)19)7(14)12(9(11)17)6(10)8(15)16/h4,6H,2-3H2,1H3,(H,15,16).
What are the key properties of 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid?
2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid has a molecular weight of 275.19 g/mol, XLogP of -0.12, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-(5-nitro-2,6-dioxo-3-propylpyrimidin-1-yl)acetic acid is sourced from PubChem (CID 81298641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).