C8H9FN2O4 — CID 81298659
2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetic acid (PubChem CID 81298659) has the molecular formula C8H9FN2O4 and a molecular weight of 216.17 g/mol. Its IUPAC name is 2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetic acid.
| Compound Name | 2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetic acid |
|---|---|
| PubChem CID | 81298659 |
| Molecular Formula | C8H9FN2O4 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-fluoroacetic acid |
| SMILES | CCc1cn(C(F)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9FN2O4/c1-2-4-3-11(5(9)7(13)14)8(15)10-6(4)12/h3,5H,2H2,1H3,(H,13,14)(H,10,12,15) |
| InChIKey | FAVYSHHOXMUXLI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |