C12H16N2O2 — CID 81299044
2-[ethyl(2-hydroxyethyl)amino]-4-methoxybenzonitrile (PubChem CID 81299044) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]-4-methoxybenzonitrile.
| Compound Name | 2-[ethyl(2-hydroxyethyl)amino]-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 81299044 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-[ethyl(2-hydroxyethyl)amino]-4-methoxybenzonitrile |
| SMILES | CCN(CCO)c1cc(OC)ccc1C#N |
| InChI | InChI=1S/C12H16N2O2/c1-3-14(6-7-15)12-8-11(16-2)5-4-10(12)9-13/h4-5,8,15H,3,6-7H2,1-2H3 |
| InChIKey | HTRKJDLUALLMCL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |