C13H19N3O2 — CID 81299535
1-[2-(aminomethyl)-5-methoxyphenyl]-1,4-diazepan-5-one (PubChem CID 81299535) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-5-methoxyphenyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-(aminomethyl)-5-methoxyphenyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 81299535 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-[2-(aminomethyl)-5-methoxyphenyl]-1,4-diazepan-5-one |
| SMILES | COc1ccc(CN)c(N2CCNC(=O)CC2)c1 |
| InChI | InChI=1S/C13H19N3O2/c1-18-11-3-2-10(9-14)12(8-11)16-6-4-13(17)15-5-7-16/h2-3,8H,4-7,9,14H2,1H3,(H,15,17) |
| InChIKey | PZEUJVPOJZPFCS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |