C16H20N2O3 — CID 81300850
1-methyl-6-(2,2,6-trimethylmorpholin-4-yl)indole-2,3-dione (PubChem CID 81300850) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-methyl-6-(2,2,6-trimethylmorpholin-4-yl)indole-2,3-dione.
| Compound Name | 1-methyl-6-(2,2,6-trimethylmorpholin-4-yl)indole-2,3-dione |
|---|---|
| PubChem CID | 81300850 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-methyl-6-(2,2,6-trimethylmorpholin-4-yl)indole-2,3-dione |
| SMILES | CC1CN(c2ccc3c(c2)N(C)C(=O)C3=O)CC(C)(C)O1 |
| InChI | InChI=1S/C16H20N2O3/c1-10-8-18(9-16(2,3)21-10)11-5-6-12-13(7-11)17(4)15(20)14(12)19/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | YBOMNRSTBIRQDM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|