About N-heptan-2-yl-1,2-dimethylpiperidin-4-amine
N-heptan-2-yl-1,2-dimethylpiperidin-4-amine (PubChem CID 81301499) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N-heptan-2-yl-1,2-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-heptan-2-yl-1,2-dimethylpiperidin-4-amine |
| PubChem CID | 81301499 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-heptan-2-yl-1,2-dimethylpiperidin-4-amine |
| SMILES | CCCCCC(C)NC1CCN(C)C(C)C1 |
| InChI | InChI=1S/C14H30N2/c1-5-6-7-8-12(2)15-14-9-10-16(4)13(3)11-14/h12-15H,5-11H2,1-4H3 |
| InChIKey | HLBQZQNKJXGLMH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-heptan-2-yl-1,2-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-2-yl-1,2-dimethylpiperidin-4-amine?
The IUPAC name of N-heptan-2-yl-1,2-dimethylpiperidin-4-amine (CID 81301499) is N-heptan-2-yl-1,2-dimethylpiperidin-4-amine.
What is the SMILES notation for N-heptan-2-yl-1,2-dimethylpiperidin-4-amine?
The canonical SMILES for N-heptan-2-yl-1,2-dimethylpiperidin-4-amine is CCCCCC(C)NC1CCN(C)C(C)C1.
What is the InChIKey of N-heptan-2-yl-1,2-dimethylpiperidin-4-amine?
The InChIKey is HLBQZQNKJXGLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2/c1-5-6-7-8-12(2)15-14-9-10-16(4)13(3)11-14/h12-15H,5-11H2,1-4H3.
What are the key properties of N-heptan-2-yl-1,2-dimethylpiperidin-4-amine?
N-heptan-2-yl-1,2-dimethylpiperidin-4-amine has a molecular weight of 226.41 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-2-yl-1,2-dimethylpiperidin-4-amine is sourced from PubChem (CID 81301499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).