C14H18ClN — CID 81301651
5-chloro-N-cyclopentyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 81301651) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is 5-chloro-N-cyclopentyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-chloro-N-cyclopentyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 81301651 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-chloro-N-cyclopentyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | Clc1ccc2c(c1)CCC2NC1CCCC1 |
| InChI | InChI=1S/C14H18ClN/c15-11-6-7-13-10(9-11)5-8-14(13)16-12-3-1-2-4-12/h6-7,9,12,14,16H,1-5,8H2 |
| InChIKey | RQLBSSNYGQORMQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |