C17H22N2O2 — CID 81301722
6-(4,4-dimethylazepan-1-yl)-1-methylindole-2,3-dione (PubChem CID 81301722) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 6-(4,4-dimethylazepan-1-yl)-1-methylindole-2,3-dione.
| Compound Name | 6-(4,4-dimethylazepan-1-yl)-1-methylindole-2,3-dione |
|---|---|
| PubChem CID | 81301722 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-(4,4-dimethylazepan-1-yl)-1-methylindole-2,3-dione |
| SMILES | CN1C(=O)C(=O)c2ccc(N3CCCC(C)(C)CC3)cc21 |
| InChI | InChI=1S/C17H22N2O2/c1-17(2)7-4-9-19(10-8-17)12-5-6-13-14(11-12)18(3)16(21)15(13)20/h5-6,11H,4,7-10H2,1-3H3 |
| InChIKey | RKTQVMFYOFMYTJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|