C11H17NOS2 — CID 81301803
3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propan-1-ol (PubChem CID 81301803) has the molecular formula C11H17NOS2 and a molecular weight of 243.40 g/mol. Its IUPAC name is 3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 81301803 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propan-1-ol |
| SMILES | C[C@H]1CC(NCCCO)c2ccsc2S1 |
| InChI | InChI=1S/C11H17NOS2/c1-8-7-10(12-4-2-5-13)9-3-6-14-11(9)15-8/h3,6,8,10,12-13H,2,4-5,7H2,1H3/t8-,10?/m0/s1 |
| InChIKey | ARJNMHICOZNMKO-PEHGTWAWSA-N |
| XLogP | 2.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|