C12H15N5O2S — CID 81302764
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-4-methoxybenzenecarboximidamide (PubChem CID 81302764) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-4-methoxybenzenecarboximidamide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-4-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 81302764 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-4-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(/C(N)=N/O)c(Sc2nnc(C)n2C)c1 |
| InChI | InChI=1S/C12H15N5O2S/c1-7-14-15-12(17(7)2)20-10-6-8(19-3)4-5-9(10)11(13)16-18/h4-6,18H,1-3H3,(H2,13,16) |
| InChIKey | KIBNFJFYXRDGBR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|