C11H11N5O — CID 81302773
4-methoxy-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile (PubChem CID 81302773) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-methoxy-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile.
| Compound Name | 4-methoxy-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 81302773 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-methoxy-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile |
| SMILES | COc1ccc(C#N)c(NCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C11H11N5O/c1-17-9-3-2-8(5-12)10(4-9)13-6-11-14-7-15-16-11/h2-4,7,13H,6H2,1H3,(H,14,15,16) |
| InChIKey | PQBKKOSKCFVCLV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |