C17H23N3O — CID 81303113
4-(1,3,4-oxadiazol-2-yl)-N-(2,4,4-trimethylcyclohexyl)aniline (PubChem CID 81303113) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-(1,3,4-oxadiazol-2-yl)-N-(2,4,4-trimethylcyclohexyl)aniline.
| Compound Name | 4-(1,3,4-oxadiazol-2-yl)-N-(2,4,4-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 81303113 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-(1,3,4-oxadiazol-2-yl)-N-(2,4,4-trimethylcyclohexyl)aniline |
| SMILES | CC1CC(C)(C)CCC1Nc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C17H23N3O/c1-12-10-17(2,3)9-8-15(12)19-14-6-4-13(5-7-14)16-20-18-11-21-16/h4-7,11-12,15,19H,8-10H2,1-3H3 |
| InChIKey | KXLZOLCDRSQGAP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |